C25H23N3O4 — CID 130384416
3,4-dimethoxy-N-[1-[(3-phenoxyphenyl)methyl]imidazol-4-yl]benzamide (PubChem CID 130384416) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[1-[(3-phenoxyphenyl)methyl]imidazol-4-yl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[1-[(3-phenoxyphenyl)methyl]imidazol-4-yl]benzamide |
|---|---|
| PubChem CID | 130384416 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 3,4-dimethoxy-N-[1-[(3-phenoxyphenyl)methyl]imidazol-4-yl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cn(Cc3cccc(Oc4ccccc4)c3)cn2)cc1OC |
| InChI | InChI=1S/C25H23N3O4/c1-30-22-12-11-19(14-23(22)31-2)25(29)27-24-16-28(17-26-24)15-18-7-6-10-21(13-18)32-20-8-4-3-5-9-20/h3-14,16-17H,15H2,1-2H3,(H,27,29) |
| InChIKey | NLVHRJWMADUQMN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |