About N-(3,4,5-trimethylphenyl)ethanimine
N-(3,4,5-trimethylphenyl)ethanimine (PubChem CID 129224731) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is N-(3,4,5-trimethylphenyl)ethanimine.
Molecular Properties
| Compound Name | N-(3,4,5-trimethylphenyl)ethanimine |
| PubChem CID | 129224731 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | N-(3,4,5-trimethylphenyl)ethanimine |
| SMILES | C/C=N/c1cc(C)c(C)c(C)c1 |
| InChI | InChI=1S/C11H15N/c1-5-12-11-6-8(2)10(4)9(3)7-11/h5-7H,1-4H3/b12-5+ |
| InChIKey | IHPLXKIRGAFCFV-LFYBBSHMSA-N |
| XLogP | 3.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4,5-trimethylphenyl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4,5-trimethylphenyl)ethanimine?
The IUPAC name of N-(3,4,5-trimethylphenyl)ethanimine (CID 129224731) is N-(3,4,5-trimethylphenyl)ethanimine.
What is the SMILES notation for N-(3,4,5-trimethylphenyl)ethanimine?
The canonical SMILES for N-(3,4,5-trimethylphenyl)ethanimine is C/C=N/c1cc(C)c(C)c(C)c1.
What is the InChIKey of N-(3,4,5-trimethylphenyl)ethanimine?
The InChIKey is IHPLXKIRGAFCFV-LFYBBSHMSA-N. The full InChI is InChI=1S/C11H15N/c1-5-12-11-6-8(2)10(4)9(3)7-11/h5-7H,1-4H3/b12-5+.
What are the key properties of N-(3,4,5-trimethylphenyl)ethanimine?
N-(3,4,5-trimethylphenyl)ethanimine has a molecular weight of 161.25 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4,5-trimethylphenyl)ethanimine is sourced from PubChem (CID 129224731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).