C29H34FN7O4 — CID 129224782
2-fluoro-5-methyl-N-[(2R)-3-methyl-1-[3-methyl-1-[(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1-oxobutan-2-yl]benzamide (PubChem CID 129224782) has the molecular formula C29H34FN7O4 and a molecular weight of 563.63 g/mol. Its IUPAC name is 2-fluoro-5-methyl-N-[(2R)-3-methyl-1-[3-methyl-1-[(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-fluoro-5-methyl-N-[(2R)-3-methyl-1-[3-methyl-1-[(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 129224782 |
| Molecular Formula | C29H34FN7O4 |
| Molecular Weight | 563.63 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | 2-fluoro-5-methyl-N-[(2R)-3-methyl-1-[3-methyl-1-[(2-methyl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1ccc(F)c(C(=O)N[C@@H](C(=O)N2CCC3(CC2)C(=O)N(C)C(=O)N3Cc2ccn3nc(C)nc3c2)C(C)C)c1 |
| InChI | InChI=1S/C29H34FN7O4/c1-17(2)24(32-25(38)21-14-18(3)6-7-22(21)30)26(39)35-12-9-29(10-13-35)27(40)34(5)28(41)36(29)16-20-8-11-37-23(15-20)31-19(4)33-37/h6-8,11,14-15,17,24H,9-10,12-13,16H2,1-5H3,(H,32,38)/t24-/m1/s1 |
| InChIKey | DGJQPYLESXLJLX-XMMPIXPASA-N |
| XLogP | 2.70 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.63 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|