C24H23F2NO3 — CID 129225263
2-(6-cyclohexyl-1H-indol-3-yl)-4-(2,4-difluorophenyl)-4-oxobutanoic acid (PubChem CID 129225263) has the molecular formula C24H23F2NO3 and a molecular weight of 411.45 g/mol. Its IUPAC name is 2-(6-cyclohexyl-1H-indol-3-yl)-4-(2,4-difluorophenyl)-4-oxobutanoic acid.
| Compound Name | 2-(6-cyclohexyl-1H-indol-3-yl)-4-(2,4-difluorophenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 129225263 |
| Molecular Formula | C24H23F2NO3 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-(6-cyclohexyl-1H-indol-3-yl)-4-(2,4-difluorophenyl)-4-oxobutanoic acid |
| SMILES | O=C(CC(C(=O)O)c1c[nH]c2cc(C3CCCCC3)ccc12)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H23F2NO3/c25-16-7-9-18(21(26)11-16)23(28)12-19(24(29)30)20-13-27-22-10-15(6-8-17(20)22)14-4-2-1-3-5-14/h6-11,13-14,19,27H,1-5,12H2,(H,29,30) |
| InChIKey | KTONQNNCWGBAIN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |