C26H25N3O3S2 — CID 129227637
(2R)-2-[(4-acetamidophenyl)sulfanylamino]-N-(furan-2-ylmethyl)-2-phenyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 129227637) has the molecular formula C26H25N3O3S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is (2R)-2-[(4-acetamidophenyl)sulfanylamino]-N-(furan-2-ylmethyl)-2-phenyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | (2R)-2-[(4-acetamidophenyl)sulfanylamino]-N-(furan-2-ylmethyl)-2-phenyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 129227637 |
| Molecular Formula | C26H25N3O3S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | (2R)-2-[(4-acetamidophenyl)sulfanylamino]-N-(furan-2-ylmethyl)-2-phenyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CC(=O)Nc1ccc(SN[C@@H](C(=O)N(Cc2ccco2)Cc2cccs2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N3O3S2/c1-19(30)27-21-11-13-23(14-12-21)34-28-25(20-7-3-2-4-8-20)26(31)29(17-22-9-5-15-32-22)18-24-10-6-16-33-24/h2-16,25,28H,17-18H2,1H3,(H,27,30)/t25-/m1/s1 |
| InChIKey | WSXMFLUBWXXHQP-RUZDIDTESA-N |
| XLogP | 5.87 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|