C34H34N4O4 — CID 129228372
butyl 2-[5-[3-[2-(2-butoxycarbonylphenyl)-1H-imidazol-5-yl]phenyl]-1H-imidazol-2-yl]benzoate (PubChem CID 129228372) has the molecular formula C34H34N4O4 and a molecular weight of 562.67 g/mol. Its IUPAC name is butyl 2-[5-[3-[2-(2-butoxycarbonylphenyl)-1H-imidazol-5-yl]phenyl]-1H-imidazol-2-yl]benzoate.
| Compound Name | butyl 2-[5-[3-[2-(2-butoxycarbonylphenyl)-1H-imidazol-5-yl]phenyl]-1H-imidazol-2-yl]benzoate |
|---|---|
| PubChem CID | 129228372 |
| Molecular Formula | C34H34N4O4 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | butyl 2-[5-[3-[2-(2-butoxycarbonylphenyl)-1H-imidazol-5-yl]phenyl]-1H-imidazol-2-yl]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1-c1ncc(-c2cccc(-c3cnc(-c4ccccc4C(=O)OCCCC)[nH]3)c2)[nH]1 |
| InChI | InChI=1S/C34H34N4O4/c1-3-5-18-41-33(39)27-16-9-7-14-25(27)31-35-21-29(37-31)23-12-11-13-24(20-23)30-22-36-32(38-30)26-15-8-10-17-28(26)34(40)42-19-6-4-2/h7-17,20-22H,3-6,18-19H2,1-2H3,(H,35,37)(H,36,38) |
| InChIKey | HLMQYMPLDKILAS-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|