C19H18F3N3O — CID 25265505
2-butoxy-3-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]pyridine (PubChem CID 25265505) has the molecular formula C19H18F3N3O and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-butoxy-3-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]pyridine.
| Compound Name | 2-butoxy-3-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]pyridine |
|---|---|
| PubChem CID | 25265505 |
| Molecular Formula | C19H18F3N3O |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 2-butoxy-3-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]pyridine |
| SMILES | CCCCOc1ncccc1-c1ncc(-c2cccc(C(F)(F)F)c2)[nH]1 |
| InChI | InChI=1S/C19H18F3N3O/c1-2-3-10-26-18-15(8-5-9-23-18)17-24-12-16(25-17)13-6-4-7-14(11-13)19(20,21)22/h4-9,11-12H,2-3,10H2,1H3,(H,24,25) |
| InChIKey | PTLZAJFSINCSLN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|