C16H10F3N2W+ — CID 22969457
2-phenyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole;tungsten(2+) (PubChem CID 22969457) has the molecular formula C16H10F3N2W+ and a molecular weight of 471.10 g/mol. Its IUPAC name is 2-phenyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole;tungsten(2+).
| Compound Name | 2-phenyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole;tungsten(2+) |
|---|---|
| PubChem CID | 22969457 |
| Molecular Formula | C16H10F3N2W+ |
| Molecular Weight | 471.10 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 2-phenyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole;tungsten(2+) |
| SMILES | FC(F)(F)c1cccc(-c2cnc(-c3c[c-]ccc3)[nH]2)c1.[W+2] |
| InChI | InChI=1S/C16H10F3N2.W/c17-16(18,19)13-8-4-7-12(9-13)14-10-20-15(21-14)11-5-2-1-3-6-11;/h1-2,4-10H,(H,20,21);/q-1;+2 |
| InChIKey | BCNUZZKWBPQWQO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.10 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|