C22H21F4N3 — CID 53322648
3-fluoro-1-[[3-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]phenyl]methyl]piperidine (PubChem CID 53322648) has the molecular formula C22H21F4N3 and a molecular weight of 403.42 g/mol. Its IUPAC name is 3-fluoro-1-[[3-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]phenyl]methyl]piperidine.
| Compound Name | 3-fluoro-1-[[3-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 53322648 |
| Molecular Formula | C22H21F4N3 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3-fluoro-1-[[3-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]phenyl]methyl]piperidine |
| SMILES | FC1CCCN(Cc2cccc(-c3ncc(-c4cccc(C(F)(F)F)c4)[nH]3)c2)C1 |
| InChI | InChI=1S/C22H21F4N3/c23-19-8-3-9-29(14-19)13-15-4-1-6-17(10-15)21-27-12-20(28-21)16-5-2-7-18(11-16)22(24,25)26/h1-2,4-7,10-12,19H,3,8-9,13-14H2,(H,27,28) |
| InChIKey | VURDZIDCCAHGMT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |