C17H13F3N2O — CID 46942875
phenyl-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]methanol (PubChem CID 46942875) has the molecular formula C17H13F3N2O and a molecular weight of 318.30 g/mol. Its IUPAC name is phenyl-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]methanol.
| Compound Name | phenyl-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]methanol |
|---|---|
| PubChem CID | 46942875 |
| Molecular Formula | C17H13F3N2O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | phenyl-[5-[3-(trifluoromethyl)phenyl]-1H-imidazol-2-yl]methanol |
| SMILES | OC(c1ccccc1)c1ncc(-c2cccc(C(F)(F)F)c2)[nH]1 |
| InChI | InChI=1S/C17H13F3N2O/c18-17(19,20)13-8-4-7-12(9-13)14-10-21-16(22-14)15(23)11-5-2-1-3-6-11/h1-10,15,23H,(H,21,22) |
| InChIKey | XQYOVPLMCCMPLA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |