C18H31NO5 — CID 129228912
tert-butyl (3aS,6R,6aR)-3,3-dimethoxy-3a-methyl-6-(2-methylprop-1-enyl)-2,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 129228912) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is tert-butyl (3aS,6R,6aR)-3,3-dimethoxy-3a-methyl-6-(2-methylprop-1-enyl)-2,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3aS,6R,6aR)-3,3-dimethoxy-3a-methyl-6-(2-methylprop-1-enyl)-2,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 129228912 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | tert-butyl (3aS,6R,6aR)-3,3-dimethoxy-3a-methyl-6-(2-methylprop-1-enyl)-2,5,6,6a-tetrahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | COC1(OC)CO[C@@H]2[C@H](C=C(C)C)CN(C(=O)OC(C)(C)C)[C@@]21C |
| InChI | InChI=1S/C18H31NO5/c1-12(2)9-13-10-19(15(20)24-16(3,4)5)17(6)14(13)23-11-18(17,21-7)22-8/h9,13-14H,10-11H2,1-8H3/t13-,14-,17+/m1/s1 |
| InChIKey | WONFGCLTBZWSCJ-CPUCHLNUSA-N |
| XLogP | 2.97 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|