C13H23NO6 — CID 76563440
tert-butyl 6-hydroxy-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate (PubChem CID 76563440) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is tert-butyl 6-hydroxy-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl 6-hydroxy-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 76563440 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | tert-butyl 6-hydroxy-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate |
| SMILES | COC1(OC)COC2C(O)CN(C(=O)OC(C)(C)C)C21 |
| InChI | InChI=1S/C13H23NO6/c1-12(2,3)20-11(16)14-6-8(15)9-10(14)13(17-4,18-5)7-19-9/h8-10,15H,6-7H2,1-5H3 |
| InChIKey | HIHMHHXVKFJDTK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|