C20H34ClNO6 — CID 58247477
tert-butyl (3R)-3-[(3aS,6R,6aS)-6-chloro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carbonyl]-5-methylhexanoate (PubChem CID 58247477) has the molecular formula C20H34ClNO6 and a molecular weight of 419.95 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(3aS,6R,6aS)-6-chloro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carbonyl]-5-methylhexanoate.
| Compound Name | tert-butyl (3R)-3-[(3aS,6R,6aS)-6-chloro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carbonyl]-5-methylhexanoate |
|---|---|
| PubChem CID | 58247477 |
| Molecular Formula | C20H34ClNO6 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | tert-butyl (3R)-3-[(3aS,6R,6aS)-6-chloro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carbonyl]-5-methylhexanoate |
| SMILES | COC1(OC)CO[C@@H]2[C@H](Cl)CN(C(=O)[C@@H](CC(=O)OC(C)(C)C)CC(C)C)[C@@H]21 |
| InChI | InChI=1S/C20H34ClNO6/c1-12(2)8-13(9-15(23)28-19(3,4)5)18(24)22-10-14(21)16-17(22)20(25-6,26-7)11-27-16/h12-14,16-17H,8-11H2,1-7H3/t13-,14-,16-,17+/m1/s1 |
| InChIKey | VSQKHBNPOVBVKM-SRABZTEZSA-N |
| XLogP | 2.59 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|