C15H25N3O4 — CID 70229298
(3aS,6S)-4-[(2S)-2-amino-4-methylpentanoyl]-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-6-carbonitrile (PubChem CID 70229298) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is (3aS,6S)-4-[(2S)-2-amino-4-methylpentanoyl]-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-6-carbonitrile.
| Compound Name | (3aS,6S)-4-[(2S)-2-amino-4-methylpentanoyl]-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-6-carbonitrile |
|---|---|
| PubChem CID | 70229298 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (3aS,6S)-4-[(2S)-2-amino-4-methylpentanoyl]-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-6-carbonitrile |
| SMILES | COC1(OC)COC2[C@H](C#N)CN(C(=O)[C@@H](N)CC(C)C)[C@@H]21 |
| InChI | InChI=1S/C15H25N3O4/c1-9(2)5-11(17)14(19)18-7-10(6-16)12-13(18)15(20-3,21-4)8-22-12/h9-13H,5,7-8,17H2,1-4H3/t10-,11+,12?,13+/m1/s1 |
| InChIKey | OUTPNHANMDOHSN-GADZMNMWSA-N |
| XLogP | 0.10 |
| TPSA | 97.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|