C17H27ClNO4- — CID 162134407
(2S)-1-[(3aS,6R,6aR)-6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-2,4-dimethylpentan-1-one chloride (PubChem CID 162134407) has the molecular formula C17H27ClNO4- and a molecular weight of 344.86 g/mol. Its IUPAC name is (2S)-1-[(3aS,6R,6aR)-6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-2,4-dimethylpentan-1-one chloride.
| Compound Name | (2S)-1-[(3aS,6R,6aR)-6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-2,4-dimethylpentan-1-one chloride |
|---|---|
| PubChem CID | 162134407 |
| Molecular Formula | C17H27ClNO4- |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2S)-1-[(3aS,6R,6aR)-6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-2,4-dimethylpentan-1-one chloride |
| SMILES | C#C[C@@H]1CN(C(=O)[C@@H](C)CC(C)C)[C@H]2[C@@H]1OCC2(OC)OC.[Cl-] |
| InChI | InChI=1S/C17H27NO4.ClH/c1-7-13-9-18(16(19)12(4)8-11(2)3)15-14(13)22-10-17(15,20-5)21-6;/h1,11-15H,8-10H2,2-6H3;1H/p-1/t12-,13+,14+,15-;/m0./s1 |
| InChIKey | CBINRFMEGKVCOG-PEVLCXCCSA-M |
| XLogP | -1.48 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|