C16H24N2O5 — CID 123162418
N-[1-(6-ethynyl-3,3-dihydroxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl)-4-methyl-1-oxopentan-2-yl]acetamide (PubChem CID 123162418) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[1-(6-ethynyl-3,3-dihydroxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl)-4-methyl-1-oxopentan-2-yl]acetamide.
| Compound Name | N-[1-(6-ethynyl-3,3-dihydroxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl)-4-methyl-1-oxopentan-2-yl]acetamide |
|---|---|
| PubChem CID | 123162418 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | N-[1-(6-ethynyl-3,3-dihydroxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl)-4-methyl-1-oxopentan-2-yl]acetamide |
| SMILES | C#CC1CN(C(=O)C(CC(C)C)NC(C)=O)C2C1OCC2(O)O |
| InChI | InChI=1S/C16H24N2O5/c1-5-11-7-18(14-13(11)23-8-16(14,21)22)15(20)12(6-9(2)3)17-10(4)19/h1,9,11-14,21-22H,6-8H2,2-4H3,(H,17,19) |
| InChIKey | YOHXCKIYPIPUGL-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|