C29H34FN5O4S — CID 45138531
N-[1-[(3aS,6R,6aR)-6-ethynyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-3-fluoro-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 45138531) has the molecular formula C29H34FN5O4S and a molecular weight of 567.69 g/mol. Its IUPAC name is N-[1-[(3aS,6R,6aR)-6-ethynyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-3-fluoro-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[1-[(3aS,6R,6aR)-6-ethynyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-3-fluoro-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 45138531 |
| Molecular Formula | C29H34FN5O4S |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | N-[1-[(3aS,6R,6aR)-6-ethynyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-3-fluoro-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | C#C[C@@H]1CN(C(=O)C(CC(C)C)NC(=O)c2ccc(-c3csc(N4CCN(C)CC4)n3)c(F)c2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C29H34FN5O4S/c1-5-18-14-35(25-24(36)15-39-26(18)25)28(38)22(12-17(2)3)31-27(37)19-6-7-20(21(30)13-19)23-16-40-29(32-23)34-10-8-33(4)9-11-34/h1,6-7,13,16-18,22,25-26H,8-12,14-15H2,2-4H3,(H,31,37)/t18-,22?,25-,26-/m1/s1 |
| InChIKey | RFCUHPQJTGIXFS-FPLUONKNSA-N |
| XLogP | 2.27 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|