C29H35ClFN5O4S — CID 66930058
N-[2-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-1-cyclohexyl-2-oxoethyl]-3-fluoro-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 66930058) has the molecular formula C29H35ClFN5O4S and a molecular weight of 604.15 g/mol. Its IUPAC name is N-[2-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-1-cyclohexyl-2-oxoethyl]-3-fluoro-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[2-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-1-cyclohexyl-2-oxoethyl]-3-fluoro-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 66930058 |
| Molecular Formula | C29H35ClFN5O4S |
| Molecular Weight | 604.15 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | N-[2-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-1-cyclohexyl-2-oxoethyl]-3-fluoro-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | CN1CCN(c2nc(-c3ccc(C(=O)NC(C(=O)N4CC(Cl)C5OCC(=O)C54)C4CCCCC4)cc3F)cs2)CC1 |
| InChI | InChI=1S/C29H35ClFN5O4S/c1-34-9-11-35(12-10-34)29-32-22(16-41-29)19-8-7-18(13-21(19)31)27(38)33-24(17-5-3-2-4-6-17)28(39)36-14-20(30)26-25(36)23(37)15-40-26/h7-8,13,16-17,20,24-26H,2-6,9-12,14-15H2,1H3,(H,33,38) |
| InChIKey | ZRQFONHKAFGDPJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|