C27H32ClF2N5O4S — CID 66929871
N-[1-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-3-methyl-1-oxopentan-2-yl]-3-fluoro-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 66929871) has the molecular formula C27H32ClF2N5O4S and a molecular weight of 596.10 g/mol. Its IUPAC name is N-[1-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-3-methyl-1-oxopentan-2-yl]-3-fluoro-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[1-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-3-methyl-1-oxopentan-2-yl]-3-fluoro-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 66929871 |
| Molecular Formula | C27H32ClF2N5O4S |
| Molecular Weight | 596.10 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | N-[1-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-3-methyl-1-oxopentan-2-yl]-3-fluoro-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | CCC(C)C(NC(=O)c1ccc(-c2nc(N3CCN(C)CC3)sc2F)c(F)c1)C(=O)N1CC(Cl)C2OCC(=O)C21 |
| InChI | InChI=1S/C27H32ClF2N5O4S/c1-4-14(2)20(26(38)35-12-17(28)23-22(35)19(36)13-39-23)31-25(37)15-5-6-16(18(29)11-15)21-24(30)40-27(32-21)34-9-7-33(3)8-10-34/h5-6,11,14,17,20,22-23H,4,7-10,12-13H2,1-3H3,(H,31,37) |
| InChIKey | CCPOYUDUCXUXJU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.10 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|