C26H31ClFN5O5S — CID 66930387
N-[1-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-3-methoxy-1-oxobutan-2-yl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 66930387) has the molecular formula C26H31ClFN5O5S and a molecular weight of 580.08 g/mol. Its IUPAC name is N-[1-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-3-methoxy-1-oxobutan-2-yl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[1-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-3-methoxy-1-oxobutan-2-yl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 66930387 |
| Molecular Formula | C26H31ClFN5O5S |
| Molecular Weight | 580.08 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | N-[1-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-3-methoxy-1-oxobutan-2-yl]-4-[5-fluoro-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | COC(C)C(NC(=O)c1ccc(-c2nc(N3CCN(C)CC3)sc2F)cc1)C(=O)N1CC(Cl)C2OCC(=O)C21 |
| InChI | InChI=1S/C26H31ClFN5O5S/c1-14(37-3)19(25(36)33-12-17(27)22-21(33)18(34)13-38-22)29-24(35)16-6-4-15(5-7-16)20-23(28)39-26(30-20)32-10-8-31(2)9-11-32/h4-7,14,17,19,21-22H,8-13H2,1-3H3,(H,29,35) |
| InChIKey | JMZUQQSVDWHEEO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.08 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|