C30H37ClFN5O4S — CID 66930189
N-[2-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-1-cyclohexyl-2-oxoethyl]-3-fluoro-4-[5-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 66930189) has the molecular formula C30H37ClFN5O4S and a molecular weight of 618.18 g/mol. Its IUPAC name is N-[2-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-1-cyclohexyl-2-oxoethyl]-3-fluoro-4-[5-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[2-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-1-cyclohexyl-2-oxoethyl]-3-fluoro-4-[5-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 66930189 |
| Molecular Formula | C30H37ClFN5O4S |
| Molecular Weight | 618.18 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | N-[2-(6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl)-1-cyclohexyl-2-oxoethyl]-3-fluoro-4-[5-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | Cc1sc(N2CCN(C)CC2)nc1-c1ccc(C(=O)NC(C(=O)N2CC(Cl)C3OCC(=O)C32)C2CCCCC2)cc1F |
| InChI | InChI=1S/C30H37ClFN5O4S/c1-17-24(34-30(42-17)36-12-10-35(2)11-13-36)20-9-8-19(14-22(20)32)28(39)33-25(18-6-4-3-5-7-18)29(40)37-15-21(31)27-26(37)23(38)16-41-27/h8-9,14,18,21,25-27H,3-7,10-13,15-16H2,1-2H3,(H,33,39) |
| InChIKey | PWUBNAIVBOJWDJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|