C29H36ClN5O4S — CID 140546171
2-[(1S)-2-[(3aS,6R,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-[5-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 140546171) has the molecular formula C29H36ClN5O4S and a molecular weight of 586.16 g/mol. Its IUPAC name is 2-[(1S)-2-[(3aS,6R,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-[5-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | 2-[(1S)-2-[(3aS,6R,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-[5-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 140546171 |
| Molecular Formula | C29H36ClN5O4S |
| Molecular Weight | 586.16 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 2-[(1S)-2-[(3aS,6R,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-[5-methyl-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | Cc1sc(N2CCN(C)CC2)nc1-c1ccc(C(N)=O)c([C@@H](C(=O)N2C[C@@H](Cl)[C@H]3OCC(=O)[C@H]32)C2CCCC2)c1 |
| InChI | InChI=1S/C29H36ClN5O4S/c1-16-24(32-29(40-16)34-11-9-33(2)10-12-34)18-7-8-19(27(31)37)20(13-18)23(17-5-3-4-6-17)28(38)35-14-21(30)26-25(35)22(36)15-39-26/h7-8,13,17,21,23,25-26H,3-6,9-12,14-15H2,1-2H3,(H2,31,37)/t21-,23+,25-,26-/m1/s1 |
| InChIKey | AJFNLIHTWZZAEY-SVVSVUQJSA-N |
| XLogP | 3.03 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|