C29H42N4O4 — CID 140563723
2-[(1S)-2-[(3aS,6S,6aR)-6-tert-butyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 140563723) has the molecular formula C29H42N4O4 and a molecular weight of 510.68 g/mol. Its IUPAC name is 2-[(1S)-2-[(3aS,6S,6aR)-6-tert-butyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 2-[(1S)-2-[(3aS,6S,6aR)-6-tert-butyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 140563723 |
| Molecular Formula | C29H42N4O4 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.32 |
| IUPAC Name | 2-[(1S)-2-[(3aS,6S,6aR)-6-tert-butyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccc(C(N)=O)c([C@@H](C(=O)N3C[C@H](C(C)(C)C)[C@H]4OCC(=O)[C@H]43)C3CCCC3)c2)CC1 |
| InChI | InChI=1S/C29H42N4O4/c1-29(2,3)22-16-33(25-23(34)17-37-26(22)25)28(36)24(18-7-5-6-8-18)21-15-19(9-10-20(21)27(30)35)32-13-11-31(4)12-14-32/h9-10,15,18,22,24-26H,5-8,11-14,16-17H2,1-4H3,(H2,30,35)/t22-,24-,25+,26+/m0/s1 |
| InChIKey | OLGXWUFEIJKYFM-ADXHGGABSA-N |
| XLogP | 2.65 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |