C31H41N5O4S — CID 140563692
2-[(1S)-2-[(3aS,6R,6aR)-6-ethyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 140563692) has the molecular formula C31H41N5O4S and a molecular weight of 579.77 g/mol. Its IUPAC name is 2-[(1S)-2-[(3aS,6R,6aR)-6-ethyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | 2-[(1S)-2-[(3aS,6R,6aR)-6-ethyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 140563692 |
| Molecular Formula | C31H41N5O4S |
| Molecular Weight | 579.77 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | 2-[(1S)-2-[(3aS,6R,6aR)-6-ethyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | CC[C@@H]1CN(C(=O)[C@H](c2cc(-c3csc(N4CCN(C)CC4)n3)ccc2C(N)=O)C2CCCCC2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C31H41N5O4S/c1-3-19-16-36(27-25(37)17-40-28(19)27)30(39)26(20-7-5-4-6-8-20)23-15-21(9-10-22(23)29(32)38)24-18-41-31(33-24)35-13-11-34(2)12-14-35/h9-10,15,18-20,26-28H,3-8,11-14,16-17H2,1-2H3,(H2,32,38)/t19-,26+,27-,28-/m1/s1 |
| InChIKey | MEJUJPRBTYTAQB-WIWHYGFKSA-N |
| XLogP | 3.53 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.77 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |