C28H40N4O4 — CID 140563660
2-[(1S)-2-[(3aS,6S,6aR)-6-ethyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-(4-ethylpiperazin-1-yl)benzamide (PubChem CID 140563660) has the molecular formula C28H40N4O4 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-[(1S)-2-[(3aS,6S,6aR)-6-ethyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-(4-ethylpiperazin-1-yl)benzamide.
| Compound Name | 2-[(1S)-2-[(3aS,6S,6aR)-6-ethyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-(4-ethylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 140563660 |
| Molecular Formula | C28H40N4O4 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 2-[(1S)-2-[(3aS,6S,6aR)-6-ethyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-(4-ethylpiperazin-1-yl)benzamide |
| SMILES | CC[C@H]1CN(C(=O)[C@H](c2cc(N3CCN(CC)CC3)ccc2C(N)=O)C2CCCC2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C28H40N4O4/c1-3-18-16-32(25-23(33)17-36-26(18)25)28(35)24(19-7-5-6-8-19)22-15-20(9-10-21(22)27(29)34)31-13-11-30(4-2)12-14-31/h9-10,15,18-19,24-26H,3-8,11-14,16-17H2,1-2H3,(H2,29,34)/t18-,24-,25+,26+/m0/s1 |
| InChIKey | CXXOTDHBZMURRQ-TYKYNWMQSA-N |
| XLogP | 2.41 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |