C28H37FN4O4 — CID 140546181
2-[(1S)-2-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide (PubChem CID 140546181) has the molecular formula C28H37FN4O4 and a molecular weight of 512.63 g/mol. Its IUPAC name is 2-[(1S)-2-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide.
| Compound Name | 2-[(1S)-2-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 140546181 |
| Molecular Formula | C28H37FN4O4 |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 2-[(1S)-2-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide |
| SMILES | NC(=O)c1ccc(N2CCN(C3CC3)CC2)cc1[C@@H](C(=O)N1C[C@H](F)[C@H]2OCC(=O)[C@H]21)C1CCCCC1 |
| InChI | InChI=1S/C28H37FN4O4/c29-22-15-33(25-23(34)16-37-26(22)25)28(36)24(17-4-2-1-3-5-17)21-14-19(8-9-20(21)27(30)35)32-12-10-31(11-13-32)18-6-7-18/h8-9,14,17-18,22,24-26H,1-7,10-13,15-16H2,(H2,30,35)/t22-,24-,25+,26+/m0/s1 |
| InChIKey | KZANYZAJQPNBIF-ADXHGGABSA-N |
| XLogP | 2.25 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |