C26H35FN4O4 — CID 24965610
N-[(1S)-2-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 24965610) has the molecular formula C26H35FN4O4 and a molecular weight of 486.59 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[(1S)-2-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 24965610 |
| Molecular Formula | C26H35FN4O4 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | N-[(1S)-2-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)N[C@H](C(=O)N3C[C@H](F)[C@H]4OCC(=O)[C@H]43)C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C26H35FN4O4/c1-29-11-13-30(14-12-29)19-9-7-18(8-10-19)25(33)28-22(17-5-3-2-4-6-17)26(34)31-15-20(27)24-23(31)21(32)16-35-24/h7-10,17,20,22-24H,2-6,11-16H2,1H3,(H,28,33)/t20-,22-,23+,24+/m0/s1 |
| InChIKey | GONCNXWXDXNNCO-IQFVJIFQSA-N |
| XLogP | 1.63 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |