C28H41N5O4 — CID 68510644
N-[(1S)-2-[(3aS,6R,6aR)-6-amino-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-propylpiperazin-1-yl)benzamide (PubChem CID 68510644) has the molecular formula C28H41N5O4 and a molecular weight of 511.67 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6R,6aR)-6-amino-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-propylpiperazin-1-yl)benzamide.
| Compound Name | N-[(1S)-2-[(3aS,6R,6aR)-6-amino-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-propylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 68510644 |
| Molecular Formula | C28H41N5O4 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | N-[(1S)-2-[(3aS,6R,6aR)-6-amino-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-propylpiperazin-1-yl)benzamide |
| SMILES | CCCN1CCN(c2ccc(C(=O)N[C@H](C(=O)N3C[C@@H](N)[C@H]4OCC(=O)[C@H]43)C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C28H41N5O4/c1-2-12-31-13-15-32(16-14-31)21-10-8-20(9-11-21)27(35)30-24(19-6-4-3-5-7-19)28(36)33-17-22(29)26-25(33)23(34)18-37-26/h8-11,19,22,24-26H,2-7,12-18,29H2,1H3,(H,30,35)/t22-,24+,25-,26-/m1/s1 |
| InChIKey | DCLLVIUROYWHMK-BIGMCNFVSA-N |
| XLogP | 1.40 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |