C29H42N4O5 — CID 68508129
N-[(1S)-2-[(3aS,6S,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-propylpiperazin-1-yl)benzamide (PubChem CID 68508129) has the molecular formula C29H42N4O5 and a molecular weight of 526.68 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6S,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-propylpiperazin-1-yl)benzamide.
| Compound Name | N-[(1S)-2-[(3aS,6S,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-propylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 68508129 |
| Molecular Formula | C29H42N4O5 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | N-[(1S)-2-[(3aS,6S,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-propylpiperazin-1-yl)benzamide |
| SMILES | CCCN1CCN(c2ccc(C(=O)N[C@H](C(=O)N3C[C@H](OC)[C@H]4OCC(=O)[C@H]43)C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C29H42N4O5/c1-3-13-31-14-16-32(17-15-31)22-11-9-21(10-12-22)28(35)30-25(20-7-5-4-6-8-20)29(36)33-18-24(37-2)27-26(33)23(34)19-38-27/h9-12,20,24-27H,3-8,13-19H2,1-2H3,(H,30,35)/t24-,25-,26+,27+/m0/s1 |
| InChIKey | FRVDWYGEKHVQAE-GWMMUDDPSA-N |
| XLogP | 2.09 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |