C30H44N4O4 — CID 67049109
N-[(1S)-2-[(3aS,6R,6aR)-6-ethyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-propylpiperazin-1-yl)benzamide (PubChem CID 67049109) has the molecular formula C30H44N4O4 and a molecular weight of 524.71 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6R,6aR)-6-ethyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-propylpiperazin-1-yl)benzamide.
| Compound Name | N-[(1S)-2-[(3aS,6R,6aR)-6-ethyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-propylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 67049109 |
| Molecular Formula | C30H44N4O4 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | N-[(1S)-2-[(3aS,6R,6aR)-6-ethyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-propylpiperazin-1-yl)benzamide |
| SMILES | CCCN1CCN(c2ccc(C(=O)N[C@H](C(=O)N3C[C@@H](CC)[C@H]4OCC(=O)[C@H]43)C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C30H44N4O4/c1-3-14-32-15-17-33(18-16-32)24-12-10-23(11-13-24)29(36)31-26(22-8-6-5-7-9-22)30(37)34-19-21(4-2)28-27(34)25(35)20-38-28/h10-13,21-22,26-28H,3-9,14-20H2,1-2H3,(H,31,36)/t21-,26+,27-,28-/m1/s1 |
| InChIKey | DVJCRVGOPJLXLG-VCVMUTABSA-N |
| XLogP | 3.10 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |