C29H40N4O4S — CID 68512323
N-[(1S)-2-[(3aS,6S,6aS)-6-methylsulfanyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide (PubChem CID 68512323) has the molecular formula C29H40N4O4S and a molecular weight of 540.73 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6S,6aS)-6-methylsulfanyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide.
| Compound Name | N-[(1S)-2-[(3aS,6S,6aS)-6-methylsulfanyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 68512323 |
| Molecular Formula | C29H40N4O4S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | N-[(1S)-2-[(3aS,6S,6aS)-6-methylsulfanyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(4-cyclopropylpiperazin-1-yl)benzamide |
| SMILES | CS[C@H]1CN(C(=O)[C@@H](NC(=O)c2ccc(N3CCN(C4CC4)CC3)cc2)C2CCCCC2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C29H40N4O4S/c1-38-24-17-33(26-23(34)18-37-27(24)26)29(36)25(19-5-3-2-4-6-19)30-28(35)20-7-9-21(10-8-20)31-13-15-32(16-14-31)22-11-12-22/h7-10,19,22,24-27H,2-6,11-18H2,1H3,(H,30,35)/t24-,25-,26+,27+/m0/s1 |
| InChIKey | SWWWBPDBMRFANQ-GWMMUDDPSA-N |
| XLogP | 2.56 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |