C28H40N4O4S — CID 68512249
N-[1-[(3aS,6S,6aS)-6-methylsulfanyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-(4-cyclobutylpiperazin-1-yl)benzamide (PubChem CID 68512249) has the molecular formula C28H40N4O4S and a molecular weight of 528.72 g/mol. Its IUPAC name is N-[1-[(3aS,6S,6aS)-6-methylsulfanyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-(4-cyclobutylpiperazin-1-yl)benzamide.
| Compound Name | N-[1-[(3aS,6S,6aS)-6-methylsulfanyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-(4-cyclobutylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 68512249 |
| Molecular Formula | C28H40N4O4S |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | N-[1-[(3aS,6S,6aS)-6-methylsulfanyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-(4-cyclobutylpiperazin-1-yl)benzamide |
| SMILES | CS[C@H]1CN(C(=O)C(CC(C)C)NC(=O)c2ccc(N3CCN(C4CCC4)CC3)cc2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C28H40N4O4S/c1-18(2)15-22(28(35)32-16-24(37-3)26-25(32)23(33)17-36-26)29-27(34)19-7-9-21(10-8-19)31-13-11-30(12-14-31)20-5-4-6-20/h7-10,18,20,22,24-26H,4-6,11-17H2,1-3H3,(H,29,34)/t22?,24-,25+,26+/m0/s1 |
| InChIKey | AUSYXOKWKRLBIP-MJOHWXICSA-N |
| XLogP | 2.42 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |