C27H38N4O5 — CID 25007631
N-[(2S)-1-[(3aS,6R,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-(4-cyclopropylpiperazin-1-yl)benzamide (PubChem CID 25007631) has the molecular formula C27H38N4O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is N-[(2S)-1-[(3aS,6R,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-(4-cyclopropylpiperazin-1-yl)benzamide.
| Compound Name | N-[(2S)-1-[(3aS,6R,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-(4-cyclopropylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 25007631 |
| Molecular Formula | C27H38N4O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | N-[(2S)-1-[(3aS,6R,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-(4-cyclopropylpiperazin-1-yl)benzamide |
| SMILES | CO[C@@H]1CN(C(=O)[C@H](CC(C)C)NC(=O)c2ccc(N3CCN(C4CC4)CC3)cc2)[C@@H]2C(=O)CO[C@@H]21 |
| InChI | InChI=1S/C27H38N4O5/c1-17(2)14-21(27(34)31-15-23(35-3)25-24(31)22(32)16-36-25)28-26(33)18-4-6-19(7-5-18)29-10-12-30(13-11-29)20-8-9-20/h4-7,17,20-21,23-25H,8-16H2,1-3H3,(H,28,33)/t21-,23+,24+,25+/m0/s1 |
| InChIKey | OAOHVEVEAHJKSD-KVZCNWPJSA-N |
| XLogP | 1.31 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |