C29H42N4O5 — CID 68508682
N-[1-[(3aS,6R,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]-4-(4-cyclobutylpiperazin-1-yl)benzamide (PubChem CID 68508682) has the molecular formula C29H42N4O5 and a molecular weight of 526.68 g/mol. Its IUPAC name is N-[1-[(3aS,6R,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]-4-(4-cyclobutylpiperazin-1-yl)benzamide.
| Compound Name | N-[1-[(3aS,6R,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]-4-(4-cyclobutylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 68508682 |
| Molecular Formula | C29H42N4O5 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | N-[1-[(3aS,6R,6aS)-6-methoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-4,4-dimethyl-1-oxopentan-2-yl]-4-(4-cyclobutylpiperazin-1-yl)benzamide |
| SMILES | CO[C@@H]1CN(C(=O)C(CC(C)(C)C)NC(=O)c2ccc(N3CCN(C4CCC4)CC3)cc2)[C@@H]2C(=O)CO[C@@H]21 |
| InChI | InChI=1S/C29H42N4O5/c1-29(2,3)16-22(28(36)33-17-24(37-4)26-25(33)23(34)18-38-26)30-27(35)19-8-10-21(11-9-19)32-14-12-31(13-15-32)20-6-5-7-20/h8-11,20,22,24-26H,5-7,12-18H2,1-4H3,(H,30,35)/t22?,24-,25-,26-/m1/s1 |
| InChIKey | MWEISHKNMLMTSO-FKCSXRDPSA-N |
| XLogP | 2.09 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |