C31H43N3O5 — CID 68512382
N-[(1S)-2-[(3aS,6S,6aS)-6-ethoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(1-cyclopropylpiperidin-4-yl)benzamide (PubChem CID 68512382) has the molecular formula C31H43N3O5 and a molecular weight of 537.70 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6S,6aS)-6-ethoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(1-cyclopropylpiperidin-4-yl)benzamide.
| Compound Name | N-[(1S)-2-[(3aS,6S,6aS)-6-ethoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(1-cyclopropylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 68512382 |
| Molecular Formula | C31H43N3O5 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | N-[(1S)-2-[(3aS,6S,6aS)-6-ethoxy-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-(1-cyclopropylpiperidin-4-yl)benzamide |
| SMILES | CCO[C@H]1CN(C(=O)[C@@H](NC(=O)c2ccc(C3CCN(C4CC4)CC3)cc2)C2CCCCC2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C31H43N3O5/c1-2-38-26-18-34(28-25(35)19-39-29(26)28)31(37)27(22-6-4-3-5-7-22)32-30(36)23-10-8-20(9-11-23)21-14-16-33(17-15-21)24-12-13-24/h8-11,21-22,24,26-29H,2-7,12-19H2,1H3,(H,32,36)/t26-,27-,28+,29+/m0/s1 |
| InChIKey | DKXCVMHEKOBGJI-QUAHOIDUSA-N |
| XLogP | 3.29 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |