C24H26ClN3O5 — CID 140695395
3-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-pyridin-4-ylfuran-2-carboxamide (PubChem CID 140695395) has the molecular formula C24H26ClN3O5 and a molecular weight of 471.94 g/mol. Its IUPAC name is 3-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-pyridin-4-ylfuran-2-carboxamide.
| Compound Name | 3-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-pyridin-4-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 140695395 |
| Molecular Formula | C24H26ClN3O5 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 3-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-pyridin-4-ylfuran-2-carboxamide |
| SMILES | NC(=O)c1oc(-c2ccncc2)cc1[C@@H](C(=O)N1C[C@H](Cl)[C@H]2OCC(=O)[C@H]21)C1CCCCC1 |
| InChI | InChI=1S/C24H26ClN3O5/c25-16-11-28(20-17(29)12-32-22(16)20)24(31)19(14-4-2-1-3-5-14)15-10-18(33-21(15)23(26)30)13-6-8-27-9-7-13/h6-10,14,16,19-20,22H,1-5,11-12H2,(H2,26,30)/t16-,19-,20+,22+/m0/s1 |
| InChIKey | LCQBLWZNRDCRNQ-VRBBWPEWSA-N |
| XLogP | 2.89 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|