C23H24ClFN4O4S — CID 130316774
N-[2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(3-fluoro-4-pyridinyl)-1,3-thiazole-2-carboxamide (PubChem CID 130316774) has the molecular formula C23H24ClFN4O4S and a molecular weight of 506.99 g/mol. Its IUPAC name is N-[2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(3-fluoro-4-pyridinyl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-[2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(3-fluoro-4-pyridinyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 130316774 |
| Molecular Formula | C23H24ClFN4O4S |
| Molecular Weight | 506.99 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | N-[2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(3-fluoro-4-pyridinyl)-1,3-thiazole-2-carboxamide |
| SMILES | O=C(NC(C(=O)N1C[C@H](Cl)[C@H]2OCC(=O)[C@H]21)C1CCCCC1)c1ncc(-c2ccncc2F)s1 |
| InChI | InChI=1S/C23H24ClFN4O4S/c24-14-10-29(19-16(30)11-33-20(14)19)23(32)18(12-4-2-1-3-5-12)28-21(31)22-27-9-17(34-22)13-6-7-26-8-15(13)25/h6-9,12,14,18-20H,1-5,10-11H2,(H,28,31)/t14-,18?,19+,20+/m0/s1 |
| InChIKey | DNKACFADGVUWHV-TZKJUKGZSA-N |
| XLogP | 2.81 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.99 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|