C25H27ClN4O4S — CID 118471708
N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-5-(2-cyclopropyl-4-pyridinyl)-1,3-thiazole-2-carboxamide (PubChem CID 118471708) has the molecular formula C25H27ClN4O4S and a molecular weight of 515.04 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-5-(2-cyclopropyl-4-pyridinyl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-5-(2-cyclopropyl-4-pyridinyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 118471708 |
| Molecular Formula | C25H27ClN4O4S |
| Molecular Weight | 515.04 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | N-[(1S)-2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-5-(2-cyclopropyl-4-pyridinyl)-1,3-thiazole-2-carboxamide |
| SMILES | O=C(N[C@H](C(=O)N1C[C@H](Cl)[C@H]2OCC(=O)[C@H]21)C1CCCC1)c1ncc(-c2ccnc(C3CC3)c2)s1 |
| InChI | InChI=1S/C25H27ClN4O4S/c26-16-11-30(21-18(31)12-34-22(16)21)25(33)20(14-3-1-2-4-14)29-23(32)24-28-10-19(35-24)15-7-8-27-17(9-15)13-5-6-13/h7-10,13-14,16,20-22H,1-6,11-12H2,(H,29,32)/t16-,20-,21+,22+/m0/s1 |
| InChIKey | MNILPHHODNVYKQ-FBEWHJACSA-N |
| XLogP | 3.16 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.04 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|