C27H30ClN3O4S — CID 130316731
N-[2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(6-cyclopropyl-3-pyridinyl)thiophene-2-carboxamide (PubChem CID 130316731) has the molecular formula C27H30ClN3O4S and a molecular weight of 528.07 g/mol. Its IUPAC name is N-[2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(6-cyclopropyl-3-pyridinyl)thiophene-2-carboxamide.
| Compound Name | N-[2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(6-cyclopropyl-3-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 130316731 |
| Molecular Formula | C27H30ClN3O4S |
| Molecular Weight | 528.07 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | N-[2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(6-cyclopropyl-3-pyridinyl)thiophene-2-carboxamide |
| SMILES | O=C(NC(C(=O)N1C[C@H](Cl)[C@H]2OCC(=O)[C@H]21)C1CCCCC1)c1ccc(-c2ccc(C3CC3)nc2)s1 |
| InChI | InChI=1S/C27H30ClN3O4S/c28-18-13-31(24-20(32)14-35-25(18)24)27(34)23(16-4-2-1-3-5-16)30-26(33)22-11-10-21(36-22)17-8-9-19(29-12-17)15-6-7-15/h8-12,15-16,18,23-25H,1-7,13-14H2,(H,30,33)/t18-,23?,24+,25+/m0/s1 |
| InChIKey | BPEQZXFPWIFQDE-IGXLIUQHSA-N |
| XLogP | 4.15 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.07 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|