C25H29ClN4O4S — CID 130316772
N-[2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(2,4-dimethylpyrimidin-5-yl)thiophene-2-carboxamide (PubChem CID 130316772) has the molecular formula C25H29ClN4O4S and a molecular weight of 517.05 g/mol. Its IUPAC name is N-[2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(2,4-dimethylpyrimidin-5-yl)thiophene-2-carboxamide.
| Compound Name | N-[2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(2,4-dimethylpyrimidin-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 130316772 |
| Molecular Formula | C25H29ClN4O4S |
| Molecular Weight | 517.05 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | N-[2-[(3aS,6S,6aS)-6-chloro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-5-(2,4-dimethylpyrimidin-5-yl)thiophene-2-carboxamide |
| SMILES | Cc1ncc(-c2ccc(C(=O)NC(C(=O)N3C[C@H](Cl)[C@H]4OCC(=O)[C@H]43)C3CCCCC3)s2)c(C)n1 |
| InChI | InChI=1S/C25H29ClN4O4S/c1-13-16(10-27-14(2)28-13)19-8-9-20(35-19)24(32)29-21(15-6-4-3-5-7-15)25(33)30-11-17(26)23-22(30)18(31)12-34-23/h8-10,15,17,21-23H,3-7,11-12H2,1-2H3,(H,29,32)/t17-,21?,22+,23+/m0/s1 |
| InChIKey | QZNZUAQJQNRICS-OWNAPAIOSA-N |
| XLogP | 3.29 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.05 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|