C31H42ClN5O5S — CID 66930378
N-[2-[(3aS,6R,6aS)-6-chloro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 66930378) has the molecular formula C31H42ClN5O5S and a molecular weight of 632.23 g/mol. Its IUPAC name is N-[2-[(3aS,6R,6aS)-6-chloro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[2-[(3aS,6R,6aS)-6-chloro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 66930378 |
| Molecular Formula | C31H42ClN5O5S |
| Molecular Weight | 632.23 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | N-[2-[(3aS,6R,6aS)-6-chloro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-1-cyclohexyl-2-oxoethyl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | COC1(OC)CO[C@@H]2[C@H](Cl)CN(C(=O)C(NC(=O)c3ccc(-c4csc(N5CCN(C)CC5)n4)cc3)C3CCCCC3)[C@@H]21 |
| InChI | InChI=1S/C31H42ClN5O5S/c1-35-13-15-36(16-14-35)30-33-24(18-43-30)20-9-11-22(12-10-20)28(38)34-25(21-7-5-4-6-8-21)29(39)37-17-23(32)26-27(37)31(40-2,41-3)19-42-26/h9-12,18,21,23,25-27H,4-8,13-17,19H2,1-3H3,(H,34,38)/t23-,25?,26-,27+/m1/s1 |
| InChIKey | VOFLWOHZEVSCID-BREYRIDKSA-N |
| XLogP | 3.45 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|