C29H40FN5O5S — CID 69162947
N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 69162947) has the molecular formula C29H40FN5O5S and a molecular weight of 589.73 g/mol. Its IUPAC name is N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 69162947 |
| Molecular Formula | C29H40FN5O5S |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrol-4-yl]-4-methyl-1-oxopentan-2-yl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | COC1(OC)CO[C@H]2[C@@H]1N(C(=O)[C@H](CC(C)C)NC(=O)c1ccc(-c3csc(N4CCN(C)CC4)n3)cc1)C[C@@H]2F |
| InChI | InChI=1S/C29H40FN5O5S/c1-18(2)14-22(27(37)35-15-21(30)24-25(35)29(38-4,39-5)17-40-24)31-26(36)20-8-6-19(7-9-20)23-16-41-28(32-23)34-12-10-33(3)11-13-34/h6-9,16,18,21-22,24-25H,10-15,17H2,1-5H3,(H,31,36)/t21-,22-,24+,25-/m0/s1 |
| InChIKey | JGINFUWMYZPPTN-HFOXQMJASA-N |
| XLogP | 2.64 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|