C32H45N5O5S — CID 91323332
N-[1-[3-(2,2-dimethoxypropoxy)-4-ethynylpyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide (PubChem CID 91323332) has the molecular formula C32H45N5O5S and a molecular weight of 611.81 g/mol. Its IUPAC name is N-[1-[3-(2,2-dimethoxypropoxy)-4-ethynylpyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[1-[3-(2,2-dimethoxypropoxy)-4-ethynylpyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 91323332 |
| Molecular Formula | C32H45N5O5S |
| Molecular Weight | 611.81 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | N-[1-[3-(2,2-dimethoxypropoxy)-4-ethynylpyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzamide |
| SMILES | C#CC1CN(C(=O)C(CC(C)C)NC(=O)c2ccc(-c3csc(N4CCN(C)CC4)n3)cc2)CC1OCC(C)(OC)OC |
| InChI | InChI=1S/C32H45N5O5S/c1-8-23-18-37(19-28(23)42-21-32(4,40-6)41-7)30(39)26(17-22(2)3)33-29(38)25-11-9-24(10-12-25)27-20-43-31(34-27)36-15-13-35(5)14-16-36/h1,9-12,20,22-23,26,28H,13-19,21H2,2-7H3,(H,33,38) |
| InChIKey | IACNQZWSZRTYRI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.81 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|