C9H17NO2 — CID 102399129
N-[(1S)-3-methyl-1-[(2R)-oxiran-2-yl]butyl]acetamide (PubChem CID 102399129) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is N-[(1S)-3-methyl-1-[(2R)-oxiran-2-yl]butyl]acetamide.
| Compound Name | N-[(1S)-3-methyl-1-[(2R)-oxiran-2-yl]butyl]acetamide |
|---|---|
| PubChem CID | 102399129 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | N-[(1S)-3-methyl-1-[(2R)-oxiran-2-yl]butyl]acetamide |
| SMILES | CC(=O)N[C@@H](CC(C)C)[C@@H]1CO1 |
| InChI | InChI=1S/C9H17NO2/c1-6(2)4-8(9-5-12-9)10-7(3)11/h6,8-9H,4-5H2,1-3H3,(H,10,11)/t8-,9-/m0/s1 |
| InChIKey | LAIJGTHUHXAQLN-IUCAKERBSA-N |
| XLogP | 0.94 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|