C7H16N2O — CID 58319717
N-[(1S)-1-amino-3-methylbutyl]acetamide (PubChem CID 58319717) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is N-[(1S)-1-amino-3-methylbutyl]acetamide.
| Compound Name | N-[(1S)-1-amino-3-methylbutyl]acetamide |
|---|---|
| PubChem CID | 58319717 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | N-[(1S)-1-amino-3-methylbutyl]acetamide |
| SMILES | CC(=O)N[C@H](N)CC(C)C |
| InChI | InChI=1S/C7H16N2O/c1-5(2)4-7(8)9-6(3)10/h5,7H,4,8H2,1-3H3,(H,9,10)/t7-/m0/s1 |
| InChIKey | KJSTZTCIOAHTSX-ZETCQYMHSA-N |
| XLogP | 0.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|