About ethane;formic acid;N-(4-methylpentan-2-yl)acetamide
ethane;formic acid;N-(4-methylpentan-2-yl)acetamide (PubChem CID 144674968) has the molecular formula C13H31NO3
and a molecular weight of 249.39 g/mol. Its IUPAC name is ethane;formic acid;N-(4-methylpentan-2-yl)acetamide.
Molecular Properties
| Compound Name | ethane;formic acid;N-(4-methylpentan-2-yl)acetamide |
| PubChem CID | 144674968 |
| Molecular Formula | C13H31NO3 |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.23 |
| IUPAC Name | ethane;formic acid;N-(4-methylpentan-2-yl)acetamide |
| SMILES | CC.CC.CC(=O)NC(C)CC(C)C.O=CO |
| InChI | InChI=1S/C8H17NO.2C2H6.CH2O2/c1-6(2)5-7(3)9-8(4)10;2*1-2;2-1-3/h6-7H,5H2,1-4H3,(H,9,10);2*1-2H3;1H,(H,2,3) |
| InChIKey | PVNZSFZNTRDABO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;formic acid;N-(4-methylpentan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formic acid;N-(4-methylpentan-2-yl)acetamide?
The IUPAC name of ethane;formic acid;N-(4-methylpentan-2-yl)acetamide (CID 144674968) is ethane;formic acid;N-(4-methylpentan-2-yl)acetamide.
What is the SMILES notation for ethane;formic acid;N-(4-methylpentan-2-yl)acetamide?
The canonical SMILES for ethane;formic acid;N-(4-methylpentan-2-yl)acetamide is CC.CC.CC(=O)NC(C)CC(C)C.O=CO.
What is the InChIKey of ethane;formic acid;N-(4-methylpentan-2-yl)acetamide?
The InChIKey is PVNZSFZNTRDABO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.2C2H6.CH2O2/c1-6(2)5-7(3)9-8(4)10;2*1-2;2-1-3/h6-7H,5H2,1-4H3,(H,9,10);2*1-2H3;1H,(H,2,3).
What are the key properties of ethane;formic acid;N-(4-methylpentan-2-yl)acetamide?
ethane;formic acid;N-(4-methylpentan-2-yl)acetamide has a molecular weight of 249.39 g/mol, XLogP of 3.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formic acid;N-(4-methylpentan-2-yl)acetamide is sourced from PubChem (CID 144674968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).