C17H33N3O2 — CID 143391135
ethane;N-[4-methyl-1-(5-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)-1-oxopentan-2-yl]acetamide (PubChem CID 143391135) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is ethane;N-[4-methyl-1-(5-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)-1-oxopentan-2-yl]acetamide.
| Compound Name | ethane;N-[4-methyl-1-(5-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)-1-oxopentan-2-yl]acetamide |
|---|---|
| PubChem CID | 143391135 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | ethane;N-[4-methyl-1-(5-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl)-1-oxopentan-2-yl]acetamide |
| SMILES | CC.CC(=O)NC(CC(C)C)C(=O)N1CCC2NC(C)CC21 |
| InChI | InChI=1S/C15H27N3O2.C2H6/c1-9(2)7-13(17-11(4)19)15(20)18-6-5-12-14(18)8-10(3)16-12;1-2/h9-10,12-14,16H,5-8H2,1-4H3,(H,17,19);1-2H3 |
| InChIKey | ADCZHTPPVIFRQQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |