C23H35N3O3 — CID 68959475
N-[(2S)-1-[(6S,6aS)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-tert-butylbenzamide (PubChem CID 68959475) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is N-[(2S)-1-[(6S,6aS)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-tert-butylbenzamide.
| Compound Name | N-[(2S)-1-[(6S,6aS)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 68959475 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | N-[(2S)-1-[(6S,6aS)-6-hydroxy-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-tert-butylbenzamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)N1CCC2NC[C@H](O)[C@H]21 |
| InChI | InChI=1S/C23H35N3O3/c1-14(2)12-18(22(29)26-11-10-17-20(26)19(27)13-24-17)25-21(28)15-6-8-16(9-7-15)23(3,4)5/h6-9,14,17-20,24,27H,10-13H2,1-5H3,(H,25,28)/t17?,18-,19-,20-/m0/s1 |
| InChIKey | IOUGYEYAXWBPCL-NIVVRJPPSA-N |
| XLogP | 2.06 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |