C29H43N3O4 — CID 58639831
N-[(2S)-1-[(3aR,6aS)-4-(4-methylpentanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-tert-butylbenzamide (PubChem CID 58639831) has the molecular formula C29H43N3O4 and a molecular weight of 497.68 g/mol. Its IUPAC name is N-[(2S)-1-[(3aR,6aS)-4-(4-methylpentanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-tert-butylbenzamide.
| Compound Name | N-[(2S)-1-[(3aR,6aS)-4-(4-methylpentanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 58639831 |
| Molecular Formula | C29H43N3O4 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | N-[(2S)-1-[(3aR,6aS)-4-(4-methylpentanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]-4-tert-butylbenzamide |
| SMILES | CC(C)CCC(=O)N1CC(=O)[C@@H]2[C@H]1CCN2C(=O)[C@H](CC(C)C)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H43N3O4/c1-18(2)8-13-25(34)32-17-24(33)26-23(32)14-15-31(26)28(36)22(16-19(3)4)30-27(35)20-9-11-21(12-10-20)29(5,6)7/h9-12,18-19,22-23,26H,8,13-17H2,1-7H3,(H,30,35)/t22-,23+,26-/m0/s1 |
| InChIKey | PECMQTVBEDPHIU-ZEVJAHDQSA-N |
| XLogP | 3.95 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |