C31H47N3O5 — CID 68887023
4-tert-butyl-N-[1-[4-(2-methoxy-4,4-dimethylpentanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 68887023) has the molecular formula C31H47N3O5 and a molecular weight of 541.73 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[4-(2-methoxy-4,4-dimethylpentanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-[4-(2-methoxy-4,4-dimethylpentanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 68887023 |
| Molecular Formula | C31H47N3O5 |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.35 |
| IUPAC Name | 4-tert-butyl-N-[1-[4-(2-methoxy-4,4-dimethylpentanoyl)-6-oxo-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-4-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | COC(CC(C)(C)C)C(=O)N1CC(=O)C2C1CCN2C(=O)C(CC(C)C)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H47N3O5/c1-19(2)16-22(32-27(36)20-10-12-21(13-11-20)31(6,7)8)28(37)33-15-14-23-26(33)24(35)18-34(23)29(38)25(39-9)17-30(3,4)5/h10-13,19,22-23,25-26H,14-18H2,1-9H3,(H,32,36) |
| InChIKey | QXJCVJBITOBYBQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |